C15H13ClF2N2O3 — CID 54161267
1-(5-chloro-2,4-dimethoxyphenyl)-3-(3,4-difluorophenyl)urea (PubChem CID 54161267) has the molecular formula C15H13ClF2N2O3 and a molecular weight of 342.73 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 54161267 |
| Molecular Formula | C15H13ClF2N2O3 |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(3,4-difluorophenyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C15H13ClF2N2O3/c1-22-13-7-14(23-2)12(6-9(13)16)20-15(21)19-8-3-4-10(17)11(18)5-8/h3-7H,1-2H3,(H2,19,20,21) |
| InChIKey | OOOITPLFNKFKRQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |