C15H13ClN4O3 — CID 10336896
1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyano-3-pyridinyl)urea (PubChem CID 10336896) has the molecular formula C15H13ClN4O3 and a molecular weight of 332.75 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyano-3-pyridinyl)urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyano-3-pyridinyl)urea |
|---|---|
| PubChem CID | 10336896 |
| Molecular Formula | C15H13ClN4O3 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyano-3-pyridinyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2ccc(C#N)nc2)cc1Cl |
| InChI | InChI=1S/C15H13ClN4O3/c1-22-13-6-14(23-2)12(5-11(13)16)20-15(21)19-10-4-3-9(7-17)18-8-10/h3-6,8H,1-2H3,(H2,19,20,21) |
| InChIKey | DVVQRRLQQAWVCC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |