C17H17ClN2O4 — CID 17270458
1-(4-acetylphenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea (PubChem CID 17270458) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea.
| Compound Name | 1-(4-acetylphenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 17270458 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-(4-acetylphenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(C(C)=O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H17ClN2O4/c1-10(21)11-4-6-12(7-5-11)19-17(22)20-14-9-15(23-2)13(18)8-16(14)24-3/h4-9H,1-3H3,(H2,19,20,22) |
| InChIKey | DMHLEAPBGPYKTC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |