C15H13BrCl2N2O3 — CID 1296806
1-(4-bromo-2-chlorophenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea (PubChem CID 1296806) has the molecular formula C15H13BrCl2N2O3 and a molecular weight of 420.09 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 1296806 |
| Molecular Formula | C15H13BrCl2N2O3 |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-(4-chloro-2,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(Br)cc2Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C15H13BrCl2N2O3/c1-22-13-7-12(14(23-2)6-10(13)18)20-15(21)19-11-4-3-8(16)5-9(11)17/h3-7H,1-2H3,(H2,19,20,21) |
| InChIKey | FYSMOEOZZBNLFA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |