C8H8BrClN2O — CID 21161446
1-(4-bromo-2-chlorophenyl)-3-methylurea (PubChem CID 21161446) has the molecular formula C8H8BrClN2O and a molecular weight of 263.52 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-methylurea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-methylurea |
|---|---|
| PubChem CID | 21161446 |
| Molecular Formula | C8H8BrClN2O |
| Molecular Weight | 263.52 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C8H8BrClN2O/c1-11-8(13)12-7-3-2-5(9)4-6(7)10/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | QVACRBZSJSYBKV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |