C13H12BrClN2O4 — CID 76992025
4-[(4-bromo-2-chlorophenyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76992025) has the molecular formula C13H12BrClN2O4 and a molecular weight of 375.61 g/mol. Its IUPAC name is 4-[(4-bromo-2-chlorophenyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(4-bromo-2-chlorophenyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76992025 |
| Molecular Formula | C13H12BrClN2O4 |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 4-[(4-bromo-2-chlorophenyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H12BrClN2O4/c1-6(7(2)12(19)20)11(18)17-13(21)16-10-4-3-8(14)5-9(10)15/h3-5H,1-2H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | STOJQAIFLQIZTD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|