C12H11BrFNO3 — CID 76991537
4-(5-bromo-2-fluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76991537) has the molecular formula C12H11BrFNO3 and a molecular weight of 316.13 g/mol. Its IUPAC name is 4-(5-bromo-2-fluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(5-bromo-2-fluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76991537 |
| Molecular Formula | C12H11BrFNO3 |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-(5-bromo-2-fluoroanilino)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H11BrFNO3/c1-6(7(2)12(17)18)11(16)15-10-5-8(13)3-4-9(10)14/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | FBJKGFPVSUFDRG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|