C9H8BrFN2O3 — CID 115179141
2-amino-3-(5-bromo-2-fluoroanilino)-3-oxopropanoic acid (PubChem CID 115179141) has the molecular formula C9H8BrFN2O3 and a molecular weight of 291.08 g/mol. Its IUPAC name is 2-amino-3-(5-bromo-2-fluoroanilino)-3-oxopropanoic acid.
| Compound Name | 2-amino-3-(5-bromo-2-fluoroanilino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115179141 |
| Molecular Formula | C9H8BrFN2O3 |
| Molecular Weight | 291.08 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 2-amino-3-(5-bromo-2-fluoroanilino)-3-oxopropanoic acid |
| SMILES | NC(C(=O)O)C(=O)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C9H8BrFN2O3/c10-4-1-2-5(11)6(3-4)13-8(14)7(12)9(15)16/h1-3,7H,12H2,(H,13,14)(H,15,16) |
| InChIKey | SSXAKVFLMBYJTL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.08 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|