C10H12BrFN2O2 — CID 81082239
2-amino-N-(5-bromo-2-fluorophenyl)-3-methoxypropanamide (PubChem CID 81082239) has the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. Its IUPAC name is 2-amino-N-(5-bromo-2-fluorophenyl)-3-methoxypropanamide.
| Compound Name | 2-amino-N-(5-bromo-2-fluorophenyl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 81082239 |
| Molecular Formula | C10H12BrFN2O2 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-amino-N-(5-bromo-2-fluorophenyl)-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C10H12BrFN2O2/c1-16-5-8(13)10(15)14-9-4-6(11)2-3-7(9)12/h2-4,8H,5,13H2,1H3,(H,14,15) |
| InChIKey | UQMGYDJHKRCCAW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |