C11H12BrFN2O4 — CID 114007198
4-[(5-bromo-2-fluorophenyl)carbamoylamino]-2-hydroxybutanoic acid (PubChem CID 114007198) has the molecular formula C11H12BrFN2O4 and a molecular weight of 335.13 g/mol. Its IUPAC name is 4-[(5-bromo-2-fluorophenyl)carbamoylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(5-bromo-2-fluorophenyl)carbamoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114007198 |
| Molecular Formula | C11H12BrFN2O4 |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4-[(5-bromo-2-fluorophenyl)carbamoylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)Nc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H12BrFN2O4/c12-6-1-2-7(13)8(5-6)15-11(19)14-4-3-9(16)10(17)18/h1-2,5,9,16H,3-4H2,(H,17,18)(H2,14,15,19) |
| InChIKey | CCBUGTOCTFCDEG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |