C12H13F3N2O4 — CID 107835137
(2S)-2-hydroxy-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid (PubChem CID 107835137) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 107835137 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2S)-2-hydroxy-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
| SMILES | O=C(NCC[C@H](O)C(=O)O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O4/c13-12(14,15)7-3-1-2-4-8(7)17-11(21)16-6-5-9(18)10(19)20/h1-4,9,18H,5-6H2,(H,19,20)(H2,16,17,21)/t9-/m0/s1 |
| InChIKey | VFWQBSSTYMTRCK-VIFPVBQESA-N |
| XLogP | 1.66 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |