C11H11F3N2O4 — CID 107840313
2-hydroxy-4-[(2,4,6-trifluorophenyl)carbamoylamino]butanoic acid (PubChem CID 107840313) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-hydroxy-4-[(2,4,6-trifluorophenyl)carbamoylamino]butanoic acid.
| Compound Name | 2-hydroxy-4-[(2,4,6-trifluorophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 107840313 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-hydroxy-4-[(2,4,6-trifluorophenyl)carbamoylamino]butanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H11F3N2O4/c12-5-3-6(13)9(7(14)4-5)16-11(20)15-2-1-8(17)10(18)19/h3-4,8,17H,1-2H2,(H,18,19)(H2,15,16,20) |
| InChIKey | HTAASRCCINMDKO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |