C13H6F6N2O — CID 11716736
1,3-bis(2,4,6-trifluorophenyl)urea (PubChem CID 11716736) has the molecular formula C13H6F6N2O and a molecular weight of 320.19 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trifluorophenyl)urea.
| Compound Name | 1,3-bis(2,4,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 11716736 |
| Molecular Formula | C13H6F6N2O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1,3-bis(2,4,6-trifluorophenyl)urea |
| SMILES | O=C(Nc1c(F)cc(F)cc1F)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H6F6N2O/c14-5-1-7(16)11(8(17)2-5)20-13(22)21-12-9(18)3-6(15)4-10(12)19/h1-4H,(H2,20,21,22) |
| InChIKey | DXDUYGJVJRJRMB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |