C13H6F5NO — CID 44586466
3,5-difluoro-N-(2,4,6-trifluorophenyl)benzamide (PubChem CID 44586466) has the molecular formula C13H6F5NO and a molecular weight of 287.19 g/mol. Its IUPAC name is 3,5-difluoro-N-(2,4,6-trifluorophenyl)benzamide.
| Compound Name | 3,5-difluoro-N-(2,4,6-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 44586466 |
| Molecular Formula | C13H6F5NO |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3,5-difluoro-N-(2,4,6-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1F)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H6F5NO/c14-7-1-6(2-8(15)3-7)13(20)19-12-10(17)4-9(16)5-11(12)18/h1-5H,(H,19,20) |
| InChIKey | UBLRJWGWOZMENF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |