C15H10F4N2O2 — CID 51106132
N-(2-acetamido-4,5-difluorophenyl)-3,5-difluorobenzamide (PubChem CID 51106132) has the molecular formula C15H10F4N2O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is N-(2-acetamido-4,5-difluorophenyl)-3,5-difluorobenzamide.
| Compound Name | N-(2-acetamido-4,5-difluorophenyl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 51106132 |
| Molecular Formula | C15H10F4N2O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(2-acetamido-4,5-difluorophenyl)-3,5-difluorobenzamide |
| SMILES | CC(=O)Nc1cc(F)c(F)cc1NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H10F4N2O2/c1-7(22)20-13-5-11(18)12(19)6-14(13)21-15(23)8-2-9(16)4-10(17)3-8/h2-6H,1H3,(H,20,22)(H,21,23) |
| InChIKey | UAVCBQYJECZJGE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |