C11H13F2N3O2 — CID 119308430
(2S)-N-(2-acetamido-4,5-difluorophenyl)-2-aminopropanamide (PubChem CID 119308430) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2S)-N-(2-acetamido-4,5-difluorophenyl)-2-aminopropanamide.
| Compound Name | (2S)-N-(2-acetamido-4,5-difluorophenyl)-2-aminopropanamide |
|---|---|
| PubChem CID | 119308430 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (2S)-N-(2-acetamido-4,5-difluorophenyl)-2-aminopropanamide |
| SMILES | CC(=O)Nc1cc(F)c(F)cc1NC(=O)[C@H](C)N |
| InChI | InChI=1S/C11H13F2N3O2/c1-5(14)11(18)16-10-4-8(13)7(12)3-9(10)15-6(2)17/h3-5H,14H2,1-2H3,(H,15,17)(H,16,18)/t5-/m0/s1 |
| InChIKey | ALBFKEAMCSASFE-YFKPBYRVSA-N |
| XLogP | 1.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |