C10H10F2N2O2 — CID 176892585
N-(4-acetamido-2,5-difluorophenyl)acetamide (PubChem CID 176892585) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is N-(4-acetamido-2,5-difluorophenyl)acetamide.
| Compound Name | N-(4-acetamido-2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 176892585 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N-(4-acetamido-2,5-difluorophenyl)acetamide |
| SMILES | CC(=O)Nc1cc(F)c(NC(C)=O)cc1F |
| InChI | InChI=1S/C10H10F2N2O2/c1-5(15)13-9-3-8(12)10(4-7(9)11)14-6(2)16/h3-4H,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | WTBIMENXELSKNQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |