C9H6F5NO — CID 14148742
N-[2,5-difluoro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 14148742) has the molecular formula C9H6F5NO and a molecular weight of 239.14 g/mol. Its IUPAC name is N-[2,5-difluoro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2,5-difluoro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 14148742 |
| Molecular Formula | C9H6F5NO |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | N-[2,5-difluoro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H6F5NO/c1-4(16)15-8-3-6(10)5(2-7(8)11)9(12,13)14/h2-3H,1H3,(H,15,16) |
| InChIKey | JRPGTXRIPYBXHZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |