C12H11F6NO — CID 4737648
N-[2,6-dimethyl-3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 4737648) has the molecular formula C12H11F6NO and a molecular weight of 299.21 g/mol. Its IUPAC name is N-[2,6-dimethyl-3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2,6-dimethyl-3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4737648 |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-[2,6-dimethyl-3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(C)c(C(F)(F)F)cc(C(F)(F)F)c1C |
| InChI | InChI=1S/C12H11F6NO/c1-5-8(11(13,14)15)4-9(12(16,17)18)6(2)10(5)19-7(3)20/h4H,1-3H3,(H,19,20) |
| InChIKey | NCWPKMZTLVATAV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |