C19H10F12O — CID 139698506
bis[2-methyl-3,5-bis(trifluoromethyl)phenyl]methanone (PubChem CID 139698506) has the molecular formula C19H10F12O and a molecular weight of 482.26 g/mol. Its IUPAC name is bis[2-methyl-3,5-bis(trifluoromethyl)phenyl]methanone.
| Compound Name | bis[2-methyl-3,5-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 139698506 |
| Molecular Formula | C19H10F12O |
| Molecular Weight | 482.26 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | bis[2-methyl-3,5-bis(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2C)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H10F12O/c1-7-11(3-9(16(20,21)22)5-13(7)18(26,27)28)15(32)12-4-10(17(23,24)25)6-14(8(12)2)19(29,30)31/h3-6H,1-2H3 |
| InChIKey | YSVGXFWAZGWNRY-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.26 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |