C12H8F6O2 — CID 135743264
(E)-3-[2-methyl-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 135743264) has the molecular formula C12H8F6O2 and a molecular weight of 298.18 g/mol. Its IUPAC name is (E)-3-[2-methyl-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-methyl-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135743264 |
| Molecular Formula | C12H8F6O2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (E)-3-[2-methyl-3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | Cc1c(/C=C/C(=O)O)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H8F6O2/c1-6-7(2-3-10(19)20)4-8(11(13,14)15)5-9(6)12(16,17)18/h2-5H,1H3,(H,19,20)/b3-2+ |
| InChIKey | HZIPLXKDFQSMON-NSCUHMNNSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|