C12H8F6O — CID 177494355
(Z)-4-[2,4-bis(trifluoromethyl)phenyl]but-3-en-2-one (PubChem CID 177494355) has the molecular formula C12H8F6O and a molecular weight of 282.18 g/mol. Its IUPAC name is (Z)-4-[2,4-bis(trifluoromethyl)phenyl]but-3-en-2-one.
| Compound Name | (Z)-4-[2,4-bis(trifluoromethyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 177494355 |
| Molecular Formula | C12H8F6O |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (Z)-4-[2,4-bis(trifluoromethyl)phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C\c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H8F6O/c1-7(19)2-3-8-4-5-9(11(13,14)15)6-10(8)12(16,17)18/h2-6H,1H3/b3-2- |
| InChIKey | QQEWWWOUTGUMKU-IHWYPQMZSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|