About [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate
[(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate (PubChem CID 10568189) has the molecular formula C14H12F6O2
and a molecular weight of 327.24 g/mol. Its IUPAC name is [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate |
| PubChem CID | 10568189 |
| Molecular Formula | C14H12F6O2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate |
| SMILES | [2H]C(C)(/C=C\c1ccc(C(F)(F)F)cc1C(F)(F)F)OC(C)=O |
| InChI | InChI=1S/C14H12F6O2/c1-8(22-9(2)21)3-4-10-5-6-11(13(15,16)17)7-12(10)14(18,19)20/h3-8H,1-2H3/b4-3-/i8D |
| InChIKey | JITGUOJFVFKETI-CCXSKQSQSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate?
The IUPAC name of [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate (CID 10568189) is [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate.
What is the SMILES notation for [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate?
The canonical SMILES for [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate is [2H]C(C)(/C=C\c1ccc(C(F)(F)F)cc1C(F)(F)F)OC(C)=O.
What is the InChIKey of [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate?
The InChIKey is JITGUOJFVFKETI-CCXSKQSQSA-N. The full InChI is InChI=1S/C14H12F6O2/c1-8(22-9(2)21)3-4-10-5-6-11(13(15,16)17)7-12(10)14(18,19)20/h3-8H,1-2H3/b4-3-/i8D.
What are the key properties of [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate?
[(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate has a molecular weight of 327.24 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-[2,4-bis(trifluoromethyl)phenyl]-2-deuteriobut-3-en-2-yl] acetate is sourced from PubChem (CID 10568189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).