C12H10F6O2 — CID 102127069
[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] acetate (PubChem CID 102127069) has the molecular formula C12H10F6O2 and a molecular weight of 300.20 g/mol. Its IUPAC name is [(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] acetate.
| Compound Name | [(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] acetate |
|---|---|
| PubChem CID | 102127069 |
| Molecular Formula | C12H10F6O2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6O2/c1-6(20-7(2)19)8-3-9(11(13,14)15)5-10(4-8)12(16,17)18/h3-6H,1-2H3/t6-/m0/s1 |
| InChIKey | VXLFALUFNAMMNJ-LURJTMIESA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |