C10H8F3NO2 — CID 123409306
3-[2-methyl-5-(trifluoromethyl)-4-pyridinyl]prop-2-enoic acid (PubChem CID 123409306) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 3-[2-methyl-5-(trifluoromethyl)-4-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[2-methyl-5-(trifluoromethyl)-4-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123409306 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-[2-methyl-5-(trifluoromethyl)-4-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H8F3NO2/c1-6-4-7(2-3-9(15)16)8(5-14-6)10(11,12)13/h2-5H,1H3,(H,15,16) |
| InChIKey | ZGMAAVKQVQPMOM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|