C17H13Cl2F6N3O3 — CID 161008124
6-chloro-N-methoxy-N-methyl-4-(trifluoromethyl)pyridin-3-amine;3-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 161008124) has the molecular formula C17H13Cl2F6N3O3 and a molecular weight of 492.20 g/mol. Its IUPAC name is 6-chloro-N-methoxy-N-methyl-4-(trifluoromethyl)pyridin-3-amine;3-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 6-chloro-N-methoxy-N-methyl-4-(trifluoromethyl)pyridin-3-amine;3-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 161008124 |
| Molecular Formula | C17H13Cl2F6N3O3 |
| Molecular Weight | 492.20 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 6-chloro-N-methoxy-N-methyl-4-(trifluoromethyl)pyridin-3-amine;3-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CON(C)c1cnc(Cl)cc1C(F)(F)F.O=C(O)C=Cc1cnc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C9H5ClF3NO2.C8H8ClF3N2O/c10-7-3-6(9(11,12)13)5(4-14-7)1-2-8(15)16;1-14(15-2)6-4-13-7(9)3-5(6)8(10,11)12/h1-4H,(H,15,16);3-4H,1-2H3 |
| InChIKey | TWTSZCSIMADUTH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.20 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|