C14H11ClF3N3O3 — CID 150863649
6-[(6-chloro-3-pyridinyl)oxy]-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 150863649) has the molecular formula C14H11ClF3N3O3 and a molecular weight of 361.71 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)oxy]-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 6-[(6-chloro-3-pyridinyl)oxy]-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150863649 |
| Molecular Formula | C14H11ClF3N3O3 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)oxy]-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1cnc(Oc2ccc(Cl)nc2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H11ClF3N3O3/c1-21(23-2)13(22)9-7-20-12(5-10(9)14(16,17)18)24-8-3-4-11(15)19-6-8/h3-7H,1-2H3 |
| InChIKey | KSPBDTKGTGCYTR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|