C11H13F3N2O2 — CID 144787110
6-ethyl-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 144787110) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 6-ethyl-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 6-ethyl-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144787110 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 6-ethyl-N-methoxy-N-methyl-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCc1cc(C(F)(F)F)c(C(=O)N(C)OC)cn1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-4-7-5-9(11(12,13)14)8(6-15-7)10(17)16(2)18-3/h5-6H,4H2,1-3H3 |
| InChIKey | SGHVTSLATVOPNP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|