C15H17F3N2O3 — CID 156788688
methyl 3-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoate (PubChem CID 156788688) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is methyl 3-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 156788688 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 3-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(NC(=O)C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O3/c1-14(2,3)13(22)20-11-7-10(15(16,17)18)9(8-19-11)5-6-12(21)23-4/h5-8H,1-4H3,(H,19,20,22) |
| InChIKey | YBVNMCKJYDXINY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|