C12H9F6NO2 — CID 86732489
methyl (E)-3-[2-amino-4,6-bis(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 86732489) has the molecular formula C12H9F6NO2 and a molecular weight of 313.20 g/mol. Its IUPAC name is methyl (E)-3-[2-amino-4,6-bis(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-amino-4,6-bis(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86732489 |
| Molecular Formula | C12H9F6NO2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | methyl (E)-3-[2-amino-4,6-bis(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1c(N)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H9F6NO2/c1-21-10(20)3-2-7-8(12(16,17)18)4-6(5-9(7)19)11(13,14)15/h2-5H,19H2,1H3/b3-2+ |
| InChIKey | UKQOEKUFCSUDKH-NSCUHMNNSA-N |
| XLogP | 3.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|