C10H6F4O2 — CID 50905551
methyl (E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate (PubChem CID 50905551) has the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. Its IUPAC name is methyl (E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 50905551 |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | methyl (E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H6F4O2/c1-16-8(15)3-2-5-9(13)6(11)4-7(12)10(5)14/h2-4H,1H3/b3-2+ |
| InChIKey | VZXKUHXNAVXOBT-NSCUHMNNSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|