C10H7ClF2O2 — CID 169478853
methyl 3-(4-chloro-3,5-difluorophenyl)prop-2-enoate (PubChem CID 169478853) has the molecular formula C10H7ClF2O2 and a molecular weight of 232.61 g/mol. Its IUPAC name is methyl 3-(4-chloro-3,5-difluorophenyl)prop-2-enoate.
| Compound Name | methyl 3-(4-chloro-3,5-difluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 169478853 |
| Molecular Formula | C10H7ClF2O2 |
| Molecular Weight | 232.61 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | methyl 3-(4-chloro-3,5-difluorophenyl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C10H7ClF2O2/c1-15-9(14)3-2-6-4-7(12)10(11)8(13)5-6/h2-5H,1H3 |
| InChIKey | SPGRJWHOQZXXJC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|