C11H9F2O6S- — CID 140660878
[2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-hydroxymethanesulfonate (PubChem CID 140660878) has the molecular formula C11H9F2O6S- and a molecular weight of 307.25 g/mol. Its IUPAC name is [2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-hydroxymethanesulfonate.
| Compound Name | [2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-hydroxymethanesulfonate |
|---|---|
| PubChem CID | 140660878 |
| Molecular Formula | C11H9F2O6S- |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | [2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-hydroxymethanesulfonate |
| SMILES | COC(=O)/C=C/c1cc(F)c(C(O)S(=O)(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C11H10F2O6S/c1-19-9(14)3-2-6-4-7(12)10(8(13)5-6)11(15)20(16,17)18/h2-5,11,15H,1H3,(H,16,17,18)/p-1/b3-2+ |
| InChIKey | PBENSZWKQYBXMX-NSCUHMNNSA-M |
| XLogP | 0.69 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|