C16H22O2 — CID 58782830
methyl (E)-3-[3,5-di(propan-2-yl)phenyl]prop-2-enoate (PubChem CID 58782830) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is methyl (E)-3-[3,5-di(propan-2-yl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3,5-di(propan-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58782830 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | methyl (E)-3-[3,5-di(propan-2-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C16H22O2/c1-11(2)14-8-13(6-7-16(17)18-5)9-15(10-14)12(3)4/h6-12H,1-5H3/b7-6+ |
| InChIKey | RDIRQUSVCPYMNR-VOTSOKGWSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|