C18H18O6 — CID 11823692
methyl (E)-3-[3,5-bis[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate (PubChem CID 11823692) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl (E)-3-[3,5-bis[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3,5-bis[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11823692 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl (E)-3-[3,5-bis[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(/C=C/C(=O)OC)cc(/C=C/C(=O)OC)c1 |
| InChI | InChI=1S/C18H18O6/c1-22-16(19)7-4-13-10-14(5-8-17(20)23-2)12-15(11-13)6-9-18(21)24-3/h4-12H,1-3H3/b7-4+,8-5+,9-6+ |
| InChIKey | SWZNPHWOFHOCRI-OTWDQPKHSA-N |
| XLogP | 2.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|