C14H16O6 — CID 72738902
methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 72738902) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 72738902 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(OC)c(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C14H16O6/c1-9(15)20-14-11(17-2)7-10(8-12(14)18-3)5-6-13(16)19-4/h5-8H,1-4H3 |
| InChIKey | QKKCBPMZPSIMIM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|