methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate

C14H16O6 — CID 72738902

IUPACmethyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate
SMILESCOC(=O)C=Cc1cc(OC)c(OC(C)=O)c(OC)c1
InChIInChI=1S/C14H16O6/c1-9(15)20-14-11(17-2)7-10(8-12(14)18-3)5-6-13(16)19-4/h5-8H,1-4H3
InChIKeyQKKCBPMZPSIMIM-UHFFFAOYSA-N
MW280.28 g/mol
LogP1.82
Rot. Bonds5

About methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate

methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 72738902) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate
PubChem CID72738902
Molecular FormulaC14H16O6
Molecular Weight280.28 g/mol
Exact Mass280.09
IUPAC Namemethyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate
SMILESCOC(=O)C=Cc1cc(OC)c(OC(C)=O)c(OC)c1
InChIInChI=1S/C14H16O6/c1-9(15)20-14-11(17-2)7-10(8-12(14)18-3)5-6-13(16)19-4/h5-8H,1-4H3
InChIKeyQKKCBPMZPSIMIM-UHFFFAOYSA-N
XLogP1.82
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.28
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate?
The IUPAC name of methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate (CID 72738902) is methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate.
What is the SMILES notation for methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate?
The canonical SMILES for methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate is COC(=O)C=Cc1cc(OC)c(OC(C)=O)c(OC)c1.
What is the InChIKey of methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate?
The InChIKey is QKKCBPMZPSIMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O6/c1-9(15)20-14-11(17-2)7-10(8-12(14)18-3)5-6-13(16)19-4/h5-8H,1-4H3.
What are the key properties of methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate?
methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate has a molecular weight of 280.28 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate is sourced from PubChem (CID 72738902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).