C21H22O8 — CID 90287738
(4-hydroxy-3-methoxyphenyl)methyl (E)-3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 90287738) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is (4-hydroxy-3-methoxyphenyl)methyl (E)-3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-hydroxy-3-methoxyphenyl)methyl (E)-3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90287738 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (4-hydroxy-3-methoxyphenyl)methyl (E)-3-(4-acetyloxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(COC(=O)/C=C/c2cc(OC)c(OC(C)=O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H22O8/c1-13(22)29-21-18(26-3)9-14(10-19(21)27-4)6-8-20(24)28-12-15-5-7-16(23)17(11-15)25-2/h5-11,23H,12H2,1-4H3/b8-6+ |
| InChIKey | LKCBFCDPIIDLGC-SOFGYWHQSA-N |
| XLogP | 3.10 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|