C19H19NO7 — CID 2534321
(4-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 2534321) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2534321 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO7/c1-24-16-10-14(11-17(25-2)19(16)26-3)6-9-18(21)27-12-13-4-7-15(8-5-13)20(22)23/h4-11H,12H2,1-3H3/b9-6+ |
| InChIKey | SWTHUZDNBGLACI-RMKNXTFCSA-N |
| XLogP | 3.38 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|