C18H17NO6 — CID 4600569
(3-nitrophenyl)methyl 3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 4600569) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (3-nitrophenyl)methyl 3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4600569 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (3-nitrophenyl)methyl 3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(C=CC(=O)OCc2cccc([N+](=O)[O-])c2)c1OC |
| InChI | InChI=1S/C18H17NO6/c1-23-16-8-4-6-14(18(16)24-2)9-10-17(20)25-12-13-5-3-7-15(11-13)19(21)22/h3-11H,12H2,1-2H3 |
| InChIKey | FWRMOYLGJGPCGL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|