C19H20O4 — CID 8873171
(3-methylphenyl)methyl (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 8873171) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3-methylphenyl)methyl (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (3-methylphenyl)methyl (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8873171 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3-methylphenyl)methyl (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCc2cccc(C)c2)c1OC |
| InChI | InChI=1S/C19H20O4/c1-14-6-4-7-15(12-14)13-23-18(20)11-10-16-8-5-9-17(21-2)19(16)22-3/h4-12H,13H2,1-3H3/b11-10+ |
| InChIKey | NOHAUYZDJOWQQN-ZHACJKMWSA-N |
| XLogP | 3.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|