C19H16Cl2O5 — CID 3958807
[2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 3958807) has the molecular formula C19H16Cl2O5 and a molecular weight of 395.24 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3958807 |
| Molecular Formula | C19H16Cl2O5 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(C=CC(=O)OCC(=O)c2ccc(Cl)cc2Cl)c1OC |
| InChI | InChI=1S/C19H16Cl2O5/c1-24-17-5-3-4-12(19(17)25-2)6-9-18(23)26-11-16(22)14-8-7-13(20)10-15(14)21/h3-10H,11H2,1-2H3 |
| InChIKey | SPWSSDRKRZDYEP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|