C22H22O7 — CID 102464852
2-[3-[2-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid (PubChem CID 102464852) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[3-[2-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid.
| Compound Name | 2-[3-[2-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 102464852 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[3-[2-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)c2cc(CC(=O)O)ccc2C)c1OC |
| InChI | InChI=1S/C22H22O7/c1-14-7-8-15(12-20(24)25)11-17(14)18(23)13-29-21(26)10-9-16-5-4-6-19(27-2)22(16)28-3/h4-11H,12-13H2,1-3H3,(H,24,25)/b10-9+ |
| InChIKey | OASYCIAELMZOGT-MDZDMXLPSA-N |
| XLogP | 3.08 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|