C19H17ClO5 — CID 2364886
[2-(4-chlorophenyl)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 2364886) has the molecular formula C19H17ClO5 and a molecular weight of 360.79 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2364886 |
| Molecular Formula | C19H17ClO5 |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)c2ccc(Cl)cc2)c1OC |
| InChI | InChI=1S/C19H17ClO5/c1-23-17-5-3-4-14(19(17)24-2)8-11-18(22)25-12-16(21)13-6-9-15(20)10-7-13/h3-11H,12H2,1-2H3/b11-8+ |
| InChIKey | QPCTXQPCMLJZIE-DHZHZOJOSA-N |
| XLogP | 3.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|