C18H14F2O4 — CID 8002802
[2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 8002802) has the molecular formula C18H14F2O4 and a molecular weight of 332.30 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8002802 |
| Molecular Formula | C18H14F2O4 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccccc1/C=C/C(=O)OCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H14F2O4/c1-23-17-5-3-2-4-12(17)7-9-18(22)24-11-16(21)13-6-8-14(19)15(20)10-13/h2-10H,11H2,1H3/b9-7+ |
| InChIKey | IEAYISVSVOEKJU-VQHVLOKHSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|