C20H19ClO5 — CID 7845689
[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 7845689) has the molecular formula C20H19ClO5 and a molecular weight of 374.82 g/mol. Its IUPAC name is [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7845689 |
| Molecular Formula | C20H19ClO5 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)O[C@H](C)C(=O)c2ccc(Cl)cc2)c1OC |
| InChI | InChI=1S/C20H19ClO5/c1-13(19(23)14-7-10-16(21)11-8-14)26-18(22)12-9-15-5-4-6-17(24-2)20(15)25-3/h4-13H,1-3H3/b12-9+/t13-/m1/s1 |
| InChIKey | PVQMOERAJZPIHO-CNELAYHGSA-N |
| XLogP | 4.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|