C22H24N2O6 — CID 8871749
[(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 8871749) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8871749 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2ccc(NC(C)=O)cc2)c1OC |
| InChI | InChI=1S/C22H24N2O6/c1-14(22(27)24-18-11-9-17(10-12-18)23-15(2)25)30-20(26)13-8-16-6-5-7-19(28-3)21(16)29-4/h5-14H,1-4H3,(H,23,25)(H,24,27)/b13-8+/t14-/m0/s1 |
| InChIKey | WASUVQUHVWVLOL-CZAWJFPGSA-N |
| XLogP | 3.25 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|