C20H18F3NO5 — CID 8837080
[(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 8837080) has the molecular formula C20H18F3NO5 and a molecular weight of 409.36 g/mol. Its IUPAC name is [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8837080 |
| Molecular Formula | C20H18F3NO5 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2ccc(F)cc2)c1OC(F)F |
| InChI | InChI=1S/C20H18F3NO5/c1-12(19(26)24-15-9-7-14(21)8-10-15)28-17(25)11-6-13-4-3-5-16(27-2)18(13)29-20(22)23/h3-12,20H,1-2H3,(H,24,26)/b11-6+/t12-/m0/s1 |
| InChIKey | GQMLVKWSUOOVNH-BCMYLCSRSA-N |
| XLogP | 4.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|