C21H27F2NO5 — CID 8974951
[(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 8974951) has the molecular formula C21H27F2NO5 and a molecular weight of 411.45 g/mol. Its IUPAC name is [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8974951 |
| Molecular Formula | C21H27F2NO5 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)O[C@@H](C)C(=O)NC2CCCCCC2)c1OC(F)F |
| InChI | InChI=1S/C21H27F2NO5/c1-14(20(26)24-16-9-5-3-4-6-10-16)28-18(25)13-12-15-8-7-11-17(27-2)19(15)29-21(22)23/h7-8,11-14,16,21H,3-6,9-10H2,1-2H3,(H,24,26)/b13-12+/t14-/m0/s1 |
| InChIKey | MBLLXKMRURBKDS-FNDVETGQSA-N |
| XLogP | 4.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|