C17H20F2O4 — CID 60599243
cyclohexyl (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 60599243) has the molecular formula C17H20F2O4 and a molecular weight of 326.34 g/mol. Its IUPAC name is cyclohexyl (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | cyclohexyl (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 60599243 |
| Molecular Formula | C17H20F2O4 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | cyclohexyl (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OC2CCCCC2)c1OC(F)F |
| InChI | InChI=1S/C17H20F2O4/c1-21-14-9-5-6-12(16(14)23-17(18)19)10-11-15(20)22-13-7-3-2-4-8-13/h5-6,9-11,13,17H,2-4,7-8H2,1H3/b11-10+ |
| InChIKey | WJQVETZNBJMQFH-ZHACJKMWSA-N |
| XLogP | 4.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|