C19H25F2NO3 — CID 55572025
(E)-N-cyclopropyl-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methylbutyl)prop-2-enamide (PubChem CID 55572025) has the molecular formula C19H25F2NO3 and a molecular weight of 353.41 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methylbutyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 55572025 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (E)-N-cyclopropyl-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methylbutyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)N(CCC(C)C)C2CC2)c1OC(F)F |
| InChI | InChI=1S/C19H25F2NO3/c1-13(2)11-12-22(15-8-9-15)17(23)10-7-14-5-4-6-16(24-3)18(14)25-19(20)21/h4-7,10,13,15,19H,8-9,11-12H2,1-3H3/b10-7+ |
| InChIKey | OPEZOGPCYUEVPE-JXMROGBWSA-N |
| XLogP | 4.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|